Index of /dicpics/WOW TCG/TCG/Crown of the Heavens
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | Zazzo Dizzleflame.png | 2019-04-22 04:08 | 1.7M | |
| Zaza_jun.png | 2019-04-22 04:08 | 1.7M | |
| Yertle.png | 2019-04-22 04:08 | 1.8M | |
| Witch Doctor Ka_boom..> | 2019-04-22 04:08 | 1.7M | |
| Wild Cascade.png | 2019-04-22 04:08 | 1.6M | |
| Wendy Anne.png | 2019-04-22 04:08 | 1.6M | |
| Warlord Grok_thol.png | 2019-04-22 04:08 | 1.5M | |
| Warlord Grok_thol - ..> | 2019-04-22 04:08 | 1.8M | |
| Vylokx.png | 2019-04-22 04:08 | 1.8M | |
| Vor_zun.png | 2019-04-22 04:08 | 1.7M | |
| Vizo Arctwister.png | 2019-04-22 04:08 | 1.6M | |
| Vindicator_s Shock.png | 2019-04-22 04:08 | 1.6M | |
| Vicious Grell.png | 2019-04-22 04:07 | 1.8M | |
| Vial of Stolen Memor..> | 2019-04-22 04:07 | 1.6M | |
| Velkin Gray.png | 2019-04-22 04:07 | 1.6M | |
| Vazu_jin.png | 2019-04-22 04:07 | 1.7M | |
| Vampiric Siphon.png | 2019-04-22 04:07 | 1.6M | |
| Unleash Inferno.png | 2019-04-22 04:07 | 1.6M | |
| Tyrus Blackhorn.png | 2019-04-22 04:07 | 1.7M | |
| Tyrus Blackhorn - Ba..> | 2019-04-22 04:07 | 1.7M | |
| Tyrande, High Priest..> | 2019-04-22 04:07 | 1.7M | |
| Tristani the Sunblad..> | 2019-04-22 04:07 | 1.7M | |
| Trag_ush.png | 2019-04-22 04:07 | 1.7M | |
| Torr_nag.png | 2019-04-22 04:07 | 1.7M | |
| Tor Earthwalker.png | 2019-04-22 04:07 | 1.7M | |
| Tommi Spazzratchet.png | 2019-04-22 04:07 | 1.5M | |
| Tidal Totem.png | 2019-04-22 04:06 | 1.7M | |
| Thunderpetal.png | 2019-04-22 04:06 | 1.7M | |
| Throk the Conqueror.png | 2019-04-22 04:06 | 1.8M | |
| Thespius Bloodblaze.png | 2019-04-22 04:06 | 1.7M | |
| The Light_s Gaze.png | 2019-04-22 04:06 | 1.5M | |
| The Battle is Won, t..> | 2019-04-22 04:06 | 1.7M | |
| The Art of War.png | 2019-04-22 04:06 | 1.7M | |
| Tharal Wildbreeze.png | 2019-04-22 04:06 | 1.6M | |
| Thadrus, Shield of T..> | 2019-04-22 04:06 | 1.6M | |
| Targus Roughblade.png | 2019-04-22 04:06 | 1.6M | |
| Sylvanas, Queen of t..> | 2019-04-22 04:06 | 1.7M | |
| Sulfuras, The Exting..> | 2019-04-22 04:06 | 1.6M | |
| Stonebranch, Ancient..> | 2019-04-22 04:06 | 1.7M | |
| Splashtooth.png | 2019-04-22 04:05 | 1.8M | |
| Spiritual Imbalance.png | 2019-04-22 04:05 | 1.6M | |
| Spaulders of the Sca..> | 2019-04-22 04:05 | 1.6M | |
| Soulde the Earthshak..> | 2019-04-22 04:05 | 1.7M | |
| Sniper Training.png | 2019-04-22 04:05 | 1.7M | |
| Skullstealer Greatax..> | 2019-04-22 04:05 | 1.6M | |
| Signed in Blood.png | 2019-04-22 04:05 | 1.7M | |
| Shroud of the Nether..> | 2019-04-22 04:05 | 1.6M | |
| Shroud of the High P..> | 2019-04-22 04:05 | 1.6M | |
| Shroud of the Archma..> | 2019-04-22 04:05 | 1.7M | |
| Shalyssa Groveshaper..> | 2019-04-22 04:05 | 1.7M | |
| Shadow Word - Despai..> | 2019-04-22 04:05 | 1.6M | |
| Shaafun.png | 2019-04-22 04:04 | 1.8M | |
| Rime and Freezin_.png | 2019-04-22 04:04 | 1.6M | |
| Remulos, Son of Cena..> | 2019-04-22 04:04 | 1.8M | |
| Reclaimed Ashkandi.png | 2019-04-22 04:04 | 1.6M | |
| Rage of the Elements..> | 2019-04-22 04:04 | 1.6M | |
| Raezi.png | 2019-04-22 04:04 | 1.7M | |
| Quick Trap.png | 2019-04-22 04:04 | 1.6M | |
| Prince Xavalis.png | 2019-04-22 04:04 | 1.7M | |
| Preserve and Protect..> | 2019-04-22 04:04 | 1.5M | |
| Power Generator Hood..> | 2019-04-22 04:04 | 1.7M | |
| Poison the Well.png | 2019-04-22 04:04 | 1.6M | |
| Paralyzing Strike.png | 2019-04-22 04:04 | 1.6M | |
| Overwhelm.png | 2019-04-22 04:04 | 1.6M | |
| Overload.png | 2019-04-22 04:04 | 1.5M | |
| Nox the Lifedrainer.png | 2019-04-22 04:03 | 1.7M | |
| Nordrassil, the Worl..> | 2019-04-22 04:03 | 1.7M | |
| Neferset Darkcaster.png | 2019-04-22 04:03 | 1.7M | |
| Muluno Sunbreath.png | 2019-04-22 04:03 | 1.7M | |
| Muln Earthfury.png | 2019-04-22 04:03 | 1.7M | |
| Monstrous Void.png | 2019-04-22 04:03 | 1.6M | |
| Monstrous Totem.png | 2019-04-22 04:03 | 1.7M | |
| Monstrous Boon.png | 2019-04-22 04:03 | 1.7M | |
| Moharu the Skyseer.png | 2019-04-22 04:03 | 1.7M | |
| Miniature Voodoo Mas..> | 2019-04-22 04:03 | 1.7M | |
| McCloud the Fox.png | 2019-04-22 04:03 | 1.6M | |
| Master_s Embrace.png | 2019-04-22 04:03 | 1.6M | |
| Mark of the Ancients..> | 2019-04-22 04:03 | 1.7M | |
| Mark of Elderlimb.png | 2019-04-22 04:03 | 1.6M | |
| Mandokir_s Tribute.png | 2019-04-22 04:02 | 1.6M | |
| Mandible of Beth_til..> | 2019-04-22 04:02 | 1.6M | |
| Malfurion_s Gift.png | 2019-04-22 04:02 | 1.6M | |
| Maimgor_s Bite.png | 2019-04-22 04:02 | 1.6M | |
| Magical Ogre Idol.png | 2019-04-22 04:02 | 1.6M | |
| Lumbering Ogre Axe.png | 2019-04-22 04:02 | 1.7M | |
| Lucy Elizabeth.png | 2019-04-22 04:02 | 1.6M | |
| Light of the Naaru.png | 2019-04-22 04:02 | 1.6M | |
| Legacy of Arlokk.png | 2019-04-22 04:02 | 1.7M | |
| Leeching Fever.png | 2019-04-22 04:02 | 1.6M | |
| Lazarus Marrowbane.png | 2019-04-22 04:02 | 1.7M | |
| Krum_shal.png | 2019-04-22 04:02 | 1.8M | |
| Krogar the Colossal.png | 2019-04-22 04:02 | 1.8M | |
| Kraznix Smolderpain.png | 2019-04-22 04:02 | 1.7M | |
| King Bargurgle, Terr..> | 2019-04-22 04:01 | 1.8M | |
| Keeper Sharus.png | 2019-04-22 04:01 | 1.8M | |
| Keeper Balos.png | 2019-04-22 04:01 | 1.7M | |
| Keeper Alinar.png | 2019-04-22 04:01 | 1.8M | |
| Kaldric Stoutwhisker..> | 2019-04-22 04:01 | 1.6M | |
| Kalam Blacksteel.png | 2019-04-22 04:01 | 1.6M | |
| Jeishal.png | 2019-04-22 04:01 | 1.6M | |
| Jadefire Trickster.png | 2019-04-22 04:01 | 1.8M | |
| Jadefire Scout.png | 2019-04-22 04:01 | 1.8M | |
| Jadefire Satyr.png | 2019-04-22 04:01 | 1.7M | |
| Jadefire Rogue.png | 2019-04-22 04:01 | 1.7M | |
| Jadefire Hellcaller.png | 2019-04-22 04:01 | 1.7M | |
| Jadefire Felsworn.png | 2019-04-22 04:01 | 1.7M | |
| Iso_rath.png | 2019-04-22 04:00 | 1.8M | |
| Iso_rath - Backside.png | 2019-04-22 04:00 | 1.7M | |
| Irontree Knives.png | 2019-04-22 04:00 | 1.6M | |
| Infectious Brutality..> | 2019-04-22 04:00 | 1.6M | |
| If You_re Not Agains..> | 2019-04-22 04:00 | 1.7M | |
| Ice Barrier.png | 2019-04-22 04:00 | 1.6M | |
| Icaros the Sunward.png | 2019-04-22 04:00 | 1.7M | |
| Ian Lanstrick.png | 2019-04-22 04:00 | 1.7M | |
| Hyjal Stag.png | 2019-04-22 04:00 | 1.6M | |
| Horngrim.png | 2019-04-22 04:00 | 1.6M | |
| High Warlord Zogar.png | 2019-04-22 04:00 | 1.7M | |
| High Prophet Barim.png | 2019-04-22 04:00 | 1.7M | |
| Hexamorph.png | 2019-04-22 03:59 | 1.5M | |
| Hemorrhage.png | 2019-04-22 03:59 | 1.6M | |
| Harpy Matriarch.png | 2019-04-22 03:59 | 1.7M | |
| Hammul Runetotem.png | 2019-04-22 03:59 | 1.7M | |
| Gutfin.png | 2019-04-22 03:59 | 1.8M | |
| Gurubashi Punisher.png | 2019-04-22 03:59 | 1.6M | |
| Grug the Bonecrusher..> | 2019-04-22 03:59 | 1.7M | |
| Grovewarden Daviak.png | 2019-04-22 03:59 | 1.7M | |
| Gronn Skullcracker.png | 2019-04-22 03:59 | 1.8M | |
| Gravitational Pull.png | 2019-04-22 03:59 | 1.6M | |
| Gravelord Adams.png | 2019-04-22 03:59 | 1.7M | |
| Grak Foulblade.png | 2019-04-22 03:59 | 1.7M | |
| Grag_tok.png | 2019-04-22 03:59 | 1.8M | |
| Graddis Battlebeard.png | 2019-04-22 03:58 | 1.7M | |
| Gerrunge the Sadist.png | 2019-04-22 03:58 | 1.6M | |
| Gakuri.png | 2019-04-22 03:58 | 1.8M | |
| Frost Blast.png | 2019-04-22 03:58 | 1.6M | |
| Frost Arc.png | 2019-04-22 03:58 | 1.6M | |
| Frimzy Fuzzbum.png | 2019-04-22 03:58 | 1.6M | |
| Flamesinger Zara.png | 2019-04-22 03:58 | 1.6M | |
| Flame Lance.png | 2019-04-22 03:58 | 1.6M | |
| Fire and Brimstone.png | 2019-04-22 03:58 | 1.6M | |
| Ferocious Cat Form.png | 2019-04-22 03:58 | 1.5M | |
| Fear and Loathing.png | 2019-04-22 03:58 | 1.6M | |
| Father Charles.png | 2019-04-22 03:58 | 1.6M | |
| Farseer Nobundo.png | 2019-04-22 03:58 | 1.7M | |
| Faithful Heal.png | 2019-04-22 03:58 | 1.6M | |
| Essence of War.png | 2019-04-22 03:57 | 1.6M | |
| Essence of Rage.png | 2019-04-22 03:57 | 1.6M | |
| Essence of Light.png | 2019-04-22 03:57 | 1.5M | |
| Essence of Focus.png | 2019-04-22 03:57 | 1.6M | |
| Essence of Defense.png | 2019-04-22 03:57 | 1.6M | |
| Essence of Aggressio..> | 2019-04-22 03:57 | 1.5M | |
| Esala.png | 2019-04-22 03:57 | 1.6M | |
| Emree.png | 2019-04-22 03:57 | 1.6M | |
| Elderguard Brennan.png | 2019-04-22 03:57 | 1.7M | |
| Earthquake.png | 2019-04-22 03:57 | 1.7M | |
| Drotara the Bloodpoi..> | 2019-04-22 03:57 | 1.6M | |
| Dro_gash.png | 2019-04-22 03:57 | 1.7M | |
| Dragonwrath, Tarecgo..> | 2019-04-22 03:57 | 1.6M | |
| Divine Bulwark.png | 2019-04-22 03:57 | 1.6M | |
| Destructive Disarm.png | 2019-04-22 03:56 | 1.6M | |
| Despair of Undeath.png | 2019-04-22 03:56 | 1.6M | |
| Deathsmasher Mogdar.png | 2019-04-22 03:56 | 1.7M | |
| Dar the Beastmaster.png | 2019-04-22 03:56 | 1.6M | |
| Dark_narr.png | 2019-04-22 03:56 | 1.8M | |
| Dark Transformation.png | 2019-04-22 03:56 | 1.6M | |
| Crown of the Ogre Ki..> | 2019-04-22 03:56 | 1.6M | |
| Crimson Guard.png | 2019-04-22 03:56 | 1.6M | |
| Corrupted Hippogryph..> | 2019-04-22 03:56 | 1.7M | |
| Cleaning House.png | 2019-04-22 03:56 | 1.7M | |
| Cenarius, Lord of th..> | 2019-04-22 03:56 | 1.8M | |
| Bubblesmash.png | 2019-04-22 03:56 | 1.8M | |
| Brutal Strike.png | 2019-04-22 03:56 | 1.6M | |
| Bromor the Shadowbla..> | 2019-04-22 03:56 | 1.6M | |
| Brogre.png | 2019-04-22 03:55 | 1.7M | |
| Branch of Nordrassil..> | 2019-04-22 03:55 | 1.6M | |
| Brainsplinter.png | 2019-04-22 03:55 | 1.6M | |
| Boundless Thievery.png | 2019-04-22 03:55 | 1.6M | |
| Boundless Rage.png | 2019-04-22 03:55 | 1.6M | |
| Borrowed Time.png | 2019-04-22 03:55 | 1.6M | |
| Blessing of the Devo..> | 2019-04-22 03:55 | 1.7M | |
| Bladestorm.png | 2019-04-22 03:55 | 1.7M | |
| Black Heart of Flame..> | 2019-04-22 03:55 | 1.7M | |
| Belt of Absolute Zer..> | 2019-04-22 03:55 | 1.6M | |
| Bash and Slash.png | 2019-04-22 03:55 | 1.6M | |
| Baru Gravehorn.png | 2019-04-22 03:55 | 1.6M | |
| Bark and Bite.png | 2019-04-22 03:55 | 1.7M | |
| Banish Soul.png | 2019-04-22 03:55 | 1.6M | |
| Baby Murloc.png | 2019-04-22 03:54 | 1.7M | |
| Assassin_s Strike.png | 2019-04-22 03:54 | 1.6M | |
| Ashroot, Ancient of ..> | 2019-04-22 03:54 | 1.7M | |
| As Hyjal Burns.png | 2019-04-22 03:54 | 1.7M | |
| Arisella, Daughter o..> | 2019-04-22 03:54 | 1.6M | |
| Arisella, Daughter o..> | 2019-04-22 03:54 | 1.8M | |
| Archdruid Malfurion ..> | 2019-04-22 03:54 | 1.6M | |
| Andrews the Just.png | 2019-04-22 03:54 | 1.6M | |
| Anathel the Eagle-Ey..> | 2019-04-22 03:54 | 1.6M | |
| An Ancient Awakens.png | 2019-04-22 03:54 | 1.7M | |
| Alyna Sunshower.png | 2019-04-22 03:54 | 1.7M | |
| Aleksei Brandal.png | 2019-04-22 03:54 | 1.6M | |
| Aessina.png | 2019-04-22 03:54 | 1.7M | |
| Aeshia Moonstreak.png | 2019-04-22 03:54 | 1.6M | |
| Abasha Windstorm.png | 2019-04-22 03:53 | 1.7M | |
|
|---|
